C22H28FN5O — CID 46972792
N-[1-(4-fluorophenyl)-2-methylpropyl]-3-(tetrazol-2-yl)adamantane-1-carboxamide (PubChem CID 46972792) has the molecular formula C22H28FN5O and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2-methylpropyl]-3-(tetrazol-2-yl)adamantane-1-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)-2-methylpropyl]-3-(tetrazol-2-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 46972792 |
| Molecular Formula | C22H28FN5O |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2-methylpropyl]-3-(tetrazol-2-yl)adamantane-1-carboxamide |
| SMILES | CC(C)C(NC(=O)C12CC3CC(C1)CC(n1ncnn1)(C3)C2)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H28FN5O/c1-14(2)19(17-3-5-18(23)6-4-17)26-20(29)21-8-15-7-16(9-21)11-22(10-15,12-21)28-25-13-24-27-28/h3-6,13-16,19H,7-12H2,1-2H3,(H,26,29) |
| InChIKey | ZPNZLJYCWHFOIQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |