C17H26N4O — CID 40554294
(5S,7R)-N-[(2R)-butan-2-yl]-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide (PubChem CID 40554294) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is (5S,7R)-N-[(2R)-butan-2-yl]-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-N-[(2R)-butan-2-yl]-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 40554294 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (5S,7R)-N-[(2R)-butan-2-yl]-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide |
| SMILES | CC[C@@H](C)NC(=O)C12C[C@H]3C[C@@H](C1)CC(n1cncn1)(C3)C2 |
| InChI | InChI=1S/C17H26N4O/c1-3-12(2)20-15(22)16-5-13-4-14(6-16)8-17(7-13,9-16)21-11-18-10-19-21/h10-14H,3-9H2,1-2H3,(H,20,22)/t12-,13-,14+,16?,17?/m1/s1 |
| InChIKey | GCWRYXUNDCRBDV-FECGAJCESA-N |
| XLogP | 2.49 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |