C20H24N4O2 — CID 19577774
(5S,7R)-N-(2-methoxyphenyl)-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide (PubChem CID 19577774) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is (5S,7R)-N-(2-methoxyphenyl)-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-N-(2-methoxyphenyl)-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 19577774 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (5S,7R)-N-(2-methoxyphenyl)-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide |
| SMILES | COc1ccccc1NC(=O)C12C[C@H]3C[C@@H](C1)CC(n1cncn1)(C3)C2 |
| InChI | InChI=1S/C20H24N4O2/c1-26-17-5-3-2-4-16(17)23-18(25)19-7-14-6-15(8-19)10-20(9-14,11-19)24-13-21-12-22-24/h2-5,12-15H,6-11H2,1H3,(H,23,25)/t14-,15+,19?,20? |
| InChIKey | UZFXHSHWRWRVOD-JNKARSBBSA-N |
| XLogP | 3.22 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |