C21H26N4O — CID 19579722
N-(2-ethylphenyl)-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide (PubChem CID 19579722) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is N-(2-ethylphenyl)-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide.
| Compound Name | N-(2-ethylphenyl)-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 19579722 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N-(2-ethylphenyl)-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide |
| SMILES | CCc1ccccc1NC(=O)C12CC3CC(C1)CC(n1cncn1)(C3)C2 |
| InChI | InChI=1S/C21H26N4O/c1-2-17-5-3-4-6-18(17)24-19(26)20-8-15-7-16(9-20)11-21(10-15,12-20)25-14-22-13-23-25/h3-6,13-16H,2,7-12H2,1H3,(H,24,26) |
| InChIKey | FHDZDONWKKBGKG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |