C16H21F3N4OS — CID 74246549
3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide (PubChem CID 74246549) has the molecular formula C16H21F3N4OS and a molecular weight of 374.43 g/mol. Its IUPAC name is 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide.
| Compound Name | 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 74246549 |
| Molecular Formula | C16H21F3N4OS |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide |
| SMILES | O=C(NCCSC(F)(F)F)C12CC3CC(C1)CC(n1cncn1)(C3)C2 |
| InChI | InChI=1S/C16H21F3N4OS/c17-16(18,19)25-2-1-21-13(24)14-4-11-3-12(5-14)7-15(6-11,8-14)23-10-20-9-22-23/h9-12H,1-8H2,(H,21,24) |
| InChIKey | QRCUPPQNZAUOOF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|