About 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide
3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide (PubChem CID 74246549) has the molecular formula C16H21F3N4OS
and a molecular weight of 374.43 g/mol. Its IUPAC name is 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide.
Molecular Properties
| Compound Name | 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide |
| PubChem CID | 74246549 |
| Molecular Formula | C16H21F3N4OS |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide |
| SMILES | O=C(NCCSC(F)(F)F)C12CC3CC(C1)CC(n1cncn1)(C3)C2 |
| InChI | InChI=1S/C16H21F3N4OS/c17-16(18,19)25-2-1-21-13(24)14-4-11-3-12(5-14)7-15(6-11,8-14)23-10-20-9-22-23/h9-12H,1-8H2,(H,21,24) |
| InChIKey | QRCUPPQNZAUOOF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide?
The IUPAC name of 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide (CID 74246549) is 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide.
What is the SMILES notation for 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide?
The canonical SMILES for 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide is O=C(NCCSC(F)(F)F)C12CC3CC(C1)CC(n1cncn1)(C3)C2.
What is the InChIKey of 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide?
The InChIKey is QRCUPPQNZAUOOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F3N4OS/c17-16(18,19)25-2-1-21-13(24)14-4-11-3-12(5-14)7-15(6-11,8-14)23-10-20-9-22-23/h9-12H,1-8H2,(H,21,24).
What are the key properties of 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide?
3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide has a molecular weight of 374.43 g/mol, XLogP of 2.94, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,4-triazol-1-yl)-N-[2-(trifluoromethylsulfanyl)ethyl]adamantane-1-carboxamide is sourced from PubChem (CID 74246549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).