C21H24N4O3 — CID 1017842
methyl 3-[[(5S,7R)-3-(1,2,4-triazol-1-yl)adamantane-1-carbonyl]amino]benzoate (PubChem CID 1017842) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is methyl 3-[[(5S,7R)-3-(1,2,4-triazol-1-yl)adamantane-1-carbonyl]amino]benzoate.
| Compound Name | methyl 3-[[(5S,7R)-3-(1,2,4-triazol-1-yl)adamantane-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 1017842 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | methyl 3-[[(5S,7R)-3-(1,2,4-triazol-1-yl)adamantane-1-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)C23C[C@H]4C[C@@H](C2)CC(n2cncn2)(C4)C3)c1 |
| InChI | InChI=1S/C21H24N4O3/c1-28-18(26)16-3-2-4-17(6-16)24-19(27)20-7-14-5-15(8-20)10-21(9-14,11-20)25-13-22-12-23-25/h2-4,6,12-15H,5,7-11H2,1H3,(H,24,27)/t14-,15+,20?,21? |
| InChIKey | GKOLRBUJMBAZEK-XFKLWTPLSA-N |
| XLogP | 3.00 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |