C19H20N6O5 — CID 98268103
(5S,7S)-N-(3-nitrophenyl)-3-(3-nitro-1,2,4-triazol-1-yl)adamantane-1-carboxamide (PubChem CID 98268103) has the molecular formula C19H20N6O5 and a molecular weight of 412.41 g/mol. Its IUPAC name is (5S,7S)-N-(3-nitrophenyl)-3-(3-nitro-1,2,4-triazol-1-yl)adamantane-1-carboxamide.
| Compound Name | (5S,7S)-N-(3-nitrophenyl)-3-(3-nitro-1,2,4-triazol-1-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98268103 |
| Molecular Formula | C19H20N6O5 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (5S,7S)-N-(3-nitrophenyl)-3-(3-nitro-1,2,4-triazol-1-yl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)C12C[C@@H]3C[C@@H](C1)CC(n1cnc([N+](=O)[O-])n1)(C3)C2 |
| InChI | InChI=1S/C19H20N6O5/c26-16(21-14-2-1-3-15(5-14)24(27)28)18-6-12-4-13(7-18)9-19(8-12,10-18)23-11-20-17(22-23)25(29)30/h1-3,5,11-13H,4,6-10H2,(H,21,26)/t12-,13-,18?,19?/m0/s1 |
| InChIKey | GEISVKREEAULSR-IJKBLAIYSA-N |
| XLogP | 3.03 |
| TPSA | 146.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|