C24H23ClN6O4 — CID 1075134
(5S,7R)-3-(3-chloro-1,2,4-triazol-1-yl)-N-(3-nitro-5-pyridin-3-yloxyphenyl)adamantane-1-carboxamide (PubChem CID 1075134) has the molecular formula C24H23ClN6O4 and a molecular weight of 494.94 g/mol. Its IUPAC name is (5S,7R)-3-(3-chloro-1,2,4-triazol-1-yl)-N-(3-nitro-5-pyridin-3-yloxyphenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-(3-chloro-1,2,4-triazol-1-yl)-N-(3-nitro-5-pyridin-3-yloxyphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 1075134 |
| Molecular Formula | C24H23ClN6O4 |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (5S,7R)-3-(3-chloro-1,2,4-triazol-1-yl)-N-(3-nitro-5-pyridin-3-yloxyphenyl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1cc(Oc2cccnc2)cc([N+](=O)[O-])c1)C12C[C@H]3C[C@@H](C1)CC(n1cnc(Cl)n1)(C3)C2 |
| InChI | InChI=1S/C24H23ClN6O4/c25-22-27-14-30(29-22)24-10-15-4-16(11-24)9-23(8-15,13-24)21(32)28-17-5-18(31(33)34)7-20(6-17)35-19-2-1-3-26-12-19/h1-3,5-7,12,14-16H,4,8-11,13H2,(H,28,32)/t15-,16+,23?,24? |
| InChIKey | UMKAVTNNQZVASU-NYRSABAFSA-N |
| XLogP | 4.96 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|