C19H20Br2N4O — CID 4057724
N-(4-bromophenyl)-3-(3-bromo-1,2,4-triazol-1-yl)adamantane-1-carboxamide (PubChem CID 4057724) has the molecular formula C19H20Br2N4O and a molecular weight of 480.20 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-(3-bromo-1,2,4-triazol-1-yl)adamantane-1-carboxamide.
| Compound Name | N-(4-bromophenyl)-3-(3-bromo-1,2,4-triazol-1-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 4057724 |
| Molecular Formula | C19H20Br2N4O |
| Molecular Weight | 480.20 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | N-(4-bromophenyl)-3-(3-bromo-1,2,4-triazol-1-yl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1)C12CC3CC(C1)CC(n1cnc(Br)n1)(C3)C2 |
| InChI | InChI=1S/C19H20Br2N4O/c20-14-1-3-15(4-2-14)23-16(26)18-6-12-5-13(7-18)9-19(8-12,10-18)25-11-22-17(21)24-25/h1-4,11-13H,5-10H2,(H,23,26) |
| InChIKey | WFGLQUCOMORGAN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.20 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |