C19H20BrIN4O — CID 3345236
3-(3-bromo-1,2,4-triazol-1-yl)-N-(2-iodophenyl)adamantane-1-carboxamide (PubChem CID 3345236) has the molecular formula C19H20BrIN4O and a molecular weight of 527.20 g/mol. Its IUPAC name is 3-(3-bromo-1,2,4-triazol-1-yl)-N-(2-iodophenyl)adamantane-1-carboxamide.
| Compound Name | 3-(3-bromo-1,2,4-triazol-1-yl)-N-(2-iodophenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 3345236 |
| Molecular Formula | C19H20BrIN4O |
| Molecular Weight | 527.20 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | 3-(3-bromo-1,2,4-triazol-1-yl)-N-(2-iodophenyl)adamantane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1I)C12CC3CC(C1)CC(n1cnc(Br)n1)(C3)C2 |
| InChI | InChI=1S/C19H20BrIN4O/c20-17-22-11-25(24-17)19-8-12-5-13(9-19)7-18(6-12,10-19)16(26)23-15-4-2-1-3-14(15)21/h1-4,11-13H,5-10H2,(H,23,26) |
| InChIKey | IMKXAXXBNNWHGA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.20 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|