C21H24N4O2 — CID 98123993
(5S,7S)-N-(3-acetylphenyl)-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide (PubChem CID 98123993) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is (5S,7S)-N-(3-acetylphenyl)-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide.
| Compound Name | (5S,7S)-N-(3-acetylphenyl)-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98123993 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (5S,7S)-N-(3-acetylphenyl)-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C23C[C@@H]4C[C@@H](C2)CC(n2cncn2)(C4)C3)c1 |
| InChI | InChI=1S/C21H24N4O2/c1-14(26)17-3-2-4-18(6-17)24-19(27)20-7-15-5-16(8-20)10-21(9-15,11-20)25-13-22-12-23-25/h2-4,6,12-13,15-16H,5,7-11H2,1H3,(H,24,27)/t15-,16-,20?,21?/m0/s1 |
| InChIKey | SVGMRVVIZBAFNB-RKAKKKFESA-N |
| XLogP | 3.41 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |