C26H28N4O — CID 98370900
(5S,7S)-N-benzyl-N-phenyl-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide (PubChem CID 98370900) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is (5S,7S)-N-benzyl-N-phenyl-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide.
| Compound Name | (5S,7S)-N-benzyl-N-phenyl-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98370900 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | (5S,7S)-N-benzyl-N-phenyl-3-(1,2,4-triazol-1-yl)adamantane-1-carboxamide |
| SMILES | O=C(N(Cc1ccccc1)c1ccccc1)C12C[C@@H]3C[C@@H](C1)CC(n1cncn1)(C3)C2 |
| InChI | InChI=1S/C26H28N4O/c31-24(29(23-9-5-2-6-10-23)16-20-7-3-1-4-8-20)25-12-21-11-22(13-25)15-26(14-21,17-25)30-19-27-18-28-30/h1-10,18-19,21-22H,11-17H2/t21-,22-,25?,26?/m0/s1 |
| InChIKey | DNYUJLWTCIEYGH-FPMFRTRJSA-N |
| XLogP | 4.81 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |