C21H30N8O — CID 131924668
N-(oxolan-2-ylmethyl)-5-[[[3-(tetrazol-2-yl)-1-adamantyl]amino]methyl]pyrimidin-2-amine (PubChem CID 131924668) has the molecular formula C21H30N8O and a molecular weight of 410.53 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-5-[[[3-(tetrazol-2-yl)-1-adamantyl]amino]methyl]pyrimidin-2-amine.
| Compound Name | N-(oxolan-2-ylmethyl)-5-[[[3-(tetrazol-2-yl)-1-adamantyl]amino]methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 131924668 |
| Molecular Formula | C21H30N8O |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-5-[[[3-(tetrazol-2-yl)-1-adamantyl]amino]methyl]pyrimidin-2-amine |
| SMILES | c1nnn(C23CC4CC(CC(NCc5cnc(NCC6CCCO6)nc5)(C4)C2)C3)n1 |
| InChI | InChI=1S/C21H30N8O/c1-2-18(30-3-1)12-24-19-22-9-17(10-23-19)11-25-20-5-15-4-16(6-20)8-21(7-15,13-20)29-27-14-26-28-29/h9-10,14-16,18,25H,1-8,11-13H2,(H,22,23,24) |
| InChIKey | WXDSNLQJZQJDIT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |