C22H22F3N5O2 — CID 59161064
N-[3-(pyridine-2-carbonylamino)-1-adamantyl]-6-(trifluoromethyl)pyrazine-2-carboxamide (PubChem CID 59161064) has the molecular formula C22H22F3N5O2 and a molecular weight of 445.45 g/mol. Its IUPAC name is N-[3-(pyridine-2-carbonylamino)-1-adamantyl]-6-(trifluoromethyl)pyrazine-2-carboxamide.
| Compound Name | N-[3-(pyridine-2-carbonylamino)-1-adamantyl]-6-(trifluoromethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 59161064 |
| Molecular Formula | C22H22F3N5O2 |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[3-(pyridine-2-carbonylamino)-1-adamantyl]-6-(trifluoromethyl)pyrazine-2-carboxamide |
| SMILES | O=C(NC12CC3CC(C1)CC(NC(=O)c1cncc(C(F)(F)F)n1)(C3)C2)c1ccccn1 |
| InChI | InChI=1S/C22H22F3N5O2/c23-22(24,25)17-11-26-10-16(28-17)19(32)30-21-8-13-5-14(9-21)7-20(6-13,12-21)29-18(31)15-3-1-2-4-27-15/h1-4,10-11,13-14H,5-9,12H2,(H,29,31)(H,30,32) |
| InChIKey | OIIFUWMKKMNLBW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |