C24H26N4O2 — CID 163795601
6-ethenyl-N-[3-(pyridine-4-carbonylamino)-1-adamantyl]pyridine-2-carboxamide (PubChem CID 163795601) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 6-ethenyl-N-[3-(pyridine-4-carbonylamino)-1-adamantyl]pyridine-2-carboxamide.
| Compound Name | 6-ethenyl-N-[3-(pyridine-4-carbonylamino)-1-adamantyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 163795601 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 6-ethenyl-N-[3-(pyridine-4-carbonylamino)-1-adamantyl]pyridine-2-carboxamide |
| SMILES | C=Cc1cccc(C(=O)NC23CC4CC(CC(NC(=O)c5ccncc5)(C4)C2)C3)n1 |
| InChI | InChI=1S/C24H26N4O2/c1-2-19-4-3-5-20(26-19)22(30)28-24-13-16-10-17(14-24)12-23(11-16,15-24)27-21(29)18-6-8-25-9-7-18/h2-9,16-17H,1,10-15H2,(H,27,29)(H,28,30) |
| InChIKey | NAMNQKQVHQHXJN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |