C24H29N5O3 — CID 58358620
N-[3-[(2-ethoxypyridine-4-carbonyl)amino]-1-adamantyl]-6-methylpyrazine-2-carboxamide (PubChem CID 58358620) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[3-[(2-ethoxypyridine-4-carbonyl)amino]-1-adamantyl]-6-methylpyrazine-2-carboxamide.
| Compound Name | N-[3-[(2-ethoxypyridine-4-carbonyl)amino]-1-adamantyl]-6-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 58358620 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[3-[(2-ethoxypyridine-4-carbonyl)amino]-1-adamantyl]-6-methylpyrazine-2-carboxamide |
| SMILES | CCOc1cc(C(=O)NC23CC4CC(C2)CC(NC(=O)c2cncc(C)n2)(C4)C3)ccn1 |
| InChI | InChI=1S/C24H29N5O3/c1-3-32-20-7-18(4-5-26-20)21(30)28-23-8-16-6-17(9-23)11-24(10-16,14-23)29-22(31)19-13-25-12-15(2)27-19/h4-5,7,12-13,16-17H,3,6,8-11,14H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | UCYKWXQTVCPBGO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |