C23H33N3O5 — CID 67323372
2-(2-methoxyethoxy)ethyl N-[3-[(6-methylpyridine-2-carbonyl)amino]-1-adamantyl]carbamate (PubChem CID 67323372) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)ethyl N-[3-[(6-methylpyridine-2-carbonyl)amino]-1-adamantyl]carbamate.
| Compound Name | 2-(2-methoxyethoxy)ethyl N-[3-[(6-methylpyridine-2-carbonyl)amino]-1-adamantyl]carbamate |
|---|---|
| PubChem CID | 67323372 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl N-[3-[(6-methylpyridine-2-carbonyl)amino]-1-adamantyl]carbamate |
| SMILES | COCCOCCOC(=O)NC12CC3CC(C1)CC(NC(=O)c1cccc(C)n1)(C3)C2 |
| InChI | InChI=1S/C23H33N3O5/c1-16-4-3-5-19(24-16)20(27)25-22-11-17-10-18(12-22)14-23(13-17,15-22)26-21(28)31-9-8-30-7-6-29-2/h3-5,17-18H,6-15H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | AIYPWUHGIZXUQJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|