C21H27N3O3 — CID 53327442
[3-[(6-methylpyridine-2-carbonyl)amino]-1-adamantyl] azetidine-1-carboxylate (PubChem CID 53327442) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is [3-[(6-methylpyridine-2-carbonyl)amino]-1-adamantyl] azetidine-1-carboxylate.
| Compound Name | [3-[(6-methylpyridine-2-carbonyl)amino]-1-adamantyl] azetidine-1-carboxylate |
|---|---|
| PubChem CID | 53327442 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [3-[(6-methylpyridine-2-carbonyl)amino]-1-adamantyl] azetidine-1-carboxylate |
| SMILES | Cc1cccc(C(=O)NC23CC4CC(C2)CC(OC(=O)N2CCC2)(C4)C3)n1 |
| InChI | InChI=1S/C21H27N3O3/c1-14-4-2-5-17(22-14)18(25)23-20-9-15-8-16(10-20)12-21(11-15,13-20)27-19(26)24-6-3-7-24/h2,4-5,15-16H,3,6-13H2,1H3,(H,23,25) |
| InChIKey | YPQQYWMCFPLLJW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |