C22H26N4O2 — CID 70497797
6-methyl-N-[5-[(3-methylbenzoyl)amino]-1-bicyclo[3.2.1]octanyl]pyrazine-2-carboxamide (PubChem CID 70497797) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 6-methyl-N-[5-[(3-methylbenzoyl)amino]-1-bicyclo[3.2.1]octanyl]pyrazine-2-carboxamide.
| Compound Name | 6-methyl-N-[5-[(3-methylbenzoyl)amino]-1-bicyclo[3.2.1]octanyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 70497797 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 6-methyl-N-[5-[(3-methylbenzoyl)amino]-1-bicyclo[3.2.1]octanyl]pyrazine-2-carboxamide |
| SMILES | Cc1cccc(C(=O)NC23CCCC(NC(=O)c4cncc(C)n4)(CC2)C3)c1 |
| InChI | InChI=1S/C22H26N4O2/c1-15-5-3-6-17(11-15)19(27)25-21-7-4-8-22(14-21,10-9-21)26-20(28)18-13-23-12-16(2)24-18/h3,5-6,11-13H,4,7-10,14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | MBZCCKMGCCLXFC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |