C21H26N6O2 — CID 123921285
N-[5-[[2-(6-methylpyrazine-2-carbonyl)hydrazinyl]methyl]-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide (PubChem CID 123921285) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-[5-[[2-(6-methylpyrazine-2-carbonyl)hydrazinyl]methyl]-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide.
| Compound Name | N-[5-[[2-(6-methylpyrazine-2-carbonyl)hydrazinyl]methyl]-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 123921285 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | N-[5-[[2-(6-methylpyrazine-2-carbonyl)hydrazinyl]methyl]-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide |
| SMILES | Cc1cncc(C(=O)NNCC23CCCC(NC(=O)c4ccccn4)(CC2)C3)n1 |
| InChI | InChI=1S/C21H26N6O2/c1-15-11-22-12-17(25-15)19(29)27-24-14-20-6-4-7-21(13-20,9-8-20)26-18(28)16-5-2-3-10-23-16/h2-3,5,10-12,24H,4,6-9,13-14H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | XCNUEYWLFVMMFH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|