C22H23N3O — CID 71535585
6-methyl-N-[(1R,5S)-5-(2-pyridin-2-ylethynyl)-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide (PubChem CID 71535585) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is 6-methyl-N-[(1R,5S)-5-(2-pyridin-2-ylethynyl)-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide.
| Compound Name | 6-methyl-N-[(1R,5S)-5-(2-pyridin-2-ylethynyl)-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71535585 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 6-methyl-N-[(1R,5S)-5-(2-pyridin-2-ylethynyl)-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide |
| SMILES | Cc1cccc(C(=O)N[C@]23CCC[C@](C#Cc4ccccn4)(CC2)C3)n1 |
| InChI | InChI=1S/C22H23N3O/c1-17-6-4-8-19(24-17)20(26)25-22-11-5-10-21(16-22,13-14-22)12-9-18-7-2-3-15-23-18/h2-4,6-8,15H,5,10-11,13-14,16H2,1H3,(H,25,26)/t21-,22+/m0/s1 |
| InChIKey | PUAGOSWCJFZYET-FCHUYYIVSA-N |
| XLogP | 3.66 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|