C23H25N3O — CID 71535582
6-methyl-N-[5-[2-(6-methyl-2-pyridinyl)ethynyl]-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide (PubChem CID 71535582) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 6-methyl-N-[5-[2-(6-methyl-2-pyridinyl)ethynyl]-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide.
| Compound Name | 6-methyl-N-[5-[2-(6-methyl-2-pyridinyl)ethynyl]-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 71535582 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 6-methyl-N-[5-[2-(6-methyl-2-pyridinyl)ethynyl]-1-bicyclo[3.2.1]octanyl]pyridine-2-carboxamide |
| SMILES | Cc1cccc(C#CC23CCCC(NC(=O)c4cccc(C)n4)(CC2)C3)n1 |
| InChI | InChI=1S/C23H25N3O/c1-17-6-3-8-19(24-17)10-13-22-11-5-12-23(16-22,15-14-22)26-21(27)20-9-4-7-18(2)25-20/h3-4,6-9H,5,11-12,14-16H2,1-2H3,(H,26,27) |
| InChIKey | RNPFGHNHOLKEGZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|