C14H16ClF3O4S — CID 57040335
[(2R)-4,4,4-trifluoro-2-methyl-1-(4-methylsulfonylphenyl)butan-2-yl] 2-chloroacetate (PubChem CID 57040335) has the molecular formula C14H16ClF3O4S and a molecular weight of 372.79 g/mol. Its IUPAC name is [(2R)-4,4,4-trifluoro-2-methyl-1-(4-methylsulfonylphenyl)butan-2-yl] 2-chloroacetate.
| Compound Name | [(2R)-4,4,4-trifluoro-2-methyl-1-(4-methylsulfonylphenyl)butan-2-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 57040335 |
| Molecular Formula | C14H16ClF3O4S |
| Molecular Weight | 372.79 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | [(2R)-4,4,4-trifluoro-2-methyl-1-(4-methylsulfonylphenyl)butan-2-yl] 2-chloroacetate |
| SMILES | C[C@@](Cc1ccc(S(C)(=O)=O)cc1)(CC(F)(F)F)OC(=O)CCl |
| InChI | InChI=1S/C14H16ClF3O4S/c1-13(9-14(16,17)18,22-12(19)8-15)7-10-3-5-11(6-4-10)23(2,20)21/h3-6H,7-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | MYJSQFVJGZYNBN-CYBMUJFWSA-N |
| XLogP | 3.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.79 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|