C14H17ClO5S — CID 22114231
[2-methyl-1-(4-methylsulfonylphenyl)-1-oxobutan-2-yl] 2-chloroacetate (PubChem CID 22114231) has the molecular formula C14H17ClO5S and a molecular weight of 332.81 g/mol. Its IUPAC name is [2-methyl-1-(4-methylsulfonylphenyl)-1-oxobutan-2-yl] 2-chloroacetate.
| Compound Name | [2-methyl-1-(4-methylsulfonylphenyl)-1-oxobutan-2-yl] 2-chloroacetate |
|---|---|
| PubChem CID | 22114231 |
| Molecular Formula | C14H17ClO5S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | [2-methyl-1-(4-methylsulfonylphenyl)-1-oxobutan-2-yl] 2-chloroacetate |
| SMILES | CCC(C)(OC(=O)CCl)C(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H17ClO5S/c1-4-14(2,20-12(16)9-15)13(17)10-5-7-11(8-6-10)21(3,18)19/h5-8H,4,9H2,1-3H3 |
| InChIKey | ZMNWXXCWLGXNSC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|