C17H24O6S — CID 11360278
[(2S)-2-methyl-1-(4-methylsulfonylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate (PubChem CID 11360278) has the molecular formula C17H24O6S and a molecular weight of 356.44 g/mol. Its IUPAC name is [(2S)-2-methyl-1-(4-methylsulfonylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate.
| Compound Name | [(2S)-2-methyl-1-(4-methylsulfonylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate |
|---|---|
| PubChem CID | 11360278 |
| Molecular Formula | C17H24O6S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [(2S)-2-methyl-1-(4-methylsulfonylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate |
| SMILES | CC[C@](C)(OC(=O)COC(C)C)C(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H24O6S/c1-6-17(4,23-15(18)11-22-12(2)3)16(19)13-7-9-14(10-8-13)24(5,20)21/h7-10,12H,6,11H2,1-5H3/t17-/m0/s1 |
| InChIKey | CPSXNXMVSHGLAF-KRWDZBQOSA-N |
| XLogP | 2.41 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |