C11H12ClNO5S — CID 68606098
2-(aminomethyl)-2-chloro-3-(4-methylsulfonylphenyl)-3-oxopropanoic acid (PubChem CID 68606098) has the molecular formula C11H12ClNO5S and a molecular weight of 305.74 g/mol. Its IUPAC name is 2-(aminomethyl)-2-chloro-3-(4-methylsulfonylphenyl)-3-oxopropanoic acid.
| Compound Name | 2-(aminomethyl)-2-chloro-3-(4-methylsulfonylphenyl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 68606098 |
| Molecular Formula | C11H12ClNO5S |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2-(aminomethyl)-2-chloro-3-(4-methylsulfonylphenyl)-3-oxopropanoic acid |
| SMILES | CS(=O)(=O)c1ccc(C(=O)C(Cl)(CN)C(=O)O)cc1 |
| InChI | InChI=1S/C11H12ClNO5S/c1-19(17,18)8-4-2-7(3-5-8)9(14)11(12,6-13)10(15)16/h2-5H,6,13H2,1H3,(H,15,16) |
| InChIKey | DKSUEDRVTPCJTQ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|