About 4-methylsulfonylbenzoic acid;1H-pyrrole
4-methylsulfonylbenzoic acid;1H-pyrrole (PubChem CID 175552248) has the molecular formula C12H13NO4S
and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-methylsulfonylbenzoic acid;1H-pyrrole.
Molecular Properties
| Compound Name | 4-methylsulfonylbenzoic acid;1H-pyrrole |
| PubChem CID | 175552248 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 4-methylsulfonylbenzoic acid;1H-pyrrole |
| SMILES | CS(=O)(=O)c1ccc(C(=O)O)cc1.c1cc[nH]c1 |
| InChI | InChI=1S/C8H8O4S.C4H5N/c1-13(11,12)7-4-2-6(3-5-7)8(9)10;1-2-4-5-3-1/h2-5H,1H3,(H,9,10);1-5H |
| InChIKey | BPKCPKSHFLKSKT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylsulfonylbenzoic acid;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfonylbenzoic acid;1H-pyrrole?
The IUPAC name of 4-methylsulfonylbenzoic acid;1H-pyrrole (CID 175552248) is 4-methylsulfonylbenzoic acid;1H-pyrrole.
What is the SMILES notation for 4-methylsulfonylbenzoic acid;1H-pyrrole?
The canonical SMILES for 4-methylsulfonylbenzoic acid;1H-pyrrole is CS(=O)(=O)c1ccc(C(=O)O)cc1.c1cc[nH]c1.
What is the InChIKey of 4-methylsulfonylbenzoic acid;1H-pyrrole?
The InChIKey is BPKCPKSHFLKSKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4S.C4H5N/c1-13(11,12)7-4-2-6(3-5-7)8(9)10;1-2-4-5-3-1/h2-5H,1H3,(H,9,10);1-5H.
What are the key properties of 4-methylsulfonylbenzoic acid;1H-pyrrole?
4-methylsulfonylbenzoic acid;1H-pyrrole has a molecular weight of 267.31 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfonylbenzoic acid;1H-pyrrole is sourced from PubChem (CID 175552248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).