About deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate
deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate (PubChem CID 159960691) has the molecular formula C17H26O4S
and a molecular weight of 327.46 g/mol. Its IUPAC name is deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate.
Molecular Properties
| Compound Name | deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate |
| PubChem CID | 159960691 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate |
| SMILES | CC[C@](C)(OC(=O)COC(C)C)C(=O)c1ccc(SC)cc1.[H][2H] |
| InChI | InChI=1S/C17H24O4S.H2/c1-6-17(4,21-15(18)11-20-12(2)3)16(19)13-7-9-14(22-5)10-8-13;/h7-10,12H,6,11H2,1-5H3;1H/t17-;/m0./s1/i;1+1 |
| InChIKey | ODHAQTUBSKOIAR-DJYNPGMBSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate?
The IUPAC name of deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate (CID 159960691) is deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate.
What is the SMILES notation for deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate?
The canonical SMILES for deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate is CC[C@](C)(OC(=O)COC(C)C)C(=O)c1ccc(SC)cc1.[H][2H].
What is the InChIKey of deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate?
The InChIKey is ODHAQTUBSKOIAR-DJYNPGMBSA-N. The full InChI is InChI=1S/C17H24O4S.H2/c1-6-17(4,21-15(18)11-20-12(2)3)16(19)13-7-9-14(22-5)10-8-13;/h7-10,12H,6,11H2,1-5H3;1H/t17-;/m0./s1/i;1+1.
What are the key properties of deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate?
deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate has a molecular weight of 327.46 g/mol, XLogP of 3.97, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for deuterium monohydride;[(2S)-2-methyl-1-(4-methylsulfanylphenyl)-1-oxobutan-2-yl] 2-propan-2-yloxyacetate is sourced from PubChem (CID 159960691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).