C13H16O3S — CID 116918376
3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutanoic acid (PubChem CID 116918376) has the molecular formula C13H16O3S and a molecular weight of 252.33 g/mol. Its IUPAC name is 3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutanoic acid.
| Compound Name | 3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 116918376 |
| Molecular Formula | C13H16O3S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3,3-dimethyl-4-(4-methylsulfanylphenyl)-4-oxobutanoic acid |
| SMILES | CSc1ccc(C(=O)C(C)(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C13H16O3S/c1-13(2,8-11(14)15)12(16)9-4-6-10(17-3)7-5-9/h4-7H,8H2,1-3H3,(H,14,15) |
| InChIKey | BYBPVIQHQJVOOA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |