C22H20O3S — CID 2754443
3-hydroxy-3-(4-methylsulfanylphenyl)-3-(4-phenylphenyl)propanoic acid (PubChem CID 2754443) has the molecular formula C22H20O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3-hydroxy-3-(4-methylsulfanylphenyl)-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 3-hydroxy-3-(4-methylsulfanylphenyl)-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 2754443 |
| Molecular Formula | C22H20O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-hydroxy-3-(4-methylsulfanylphenyl)-3-(4-phenylphenyl)propanoic acid |
| SMILES | CSc1ccc(C(O)(CC(=O)O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H20O3S/c1-26-20-13-11-19(12-14-20)22(25,15-21(23)24)18-9-7-17(8-10-18)16-5-3-2-4-6-16/h2-14,25H,15H2,1H3,(H,23,24) |
| InChIKey | PFLUYVDPPNNHND-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |