C14H16O4S — CID 175973541
(E)-2-methyl-2-(4-methylsulfanylphenyl)hex-3-enedioic acid (PubChem CID 175973541) has the molecular formula C14H16O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is (E)-2-methyl-2-(4-methylsulfanylphenyl)hex-3-enedioic acid.
| Compound Name | (E)-2-methyl-2-(4-methylsulfanylphenyl)hex-3-enedioic acid |
|---|---|
| PubChem CID | 175973541 |
| Molecular Formula | C14H16O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (E)-2-methyl-2-(4-methylsulfanylphenyl)hex-3-enedioic acid |
| SMILES | CSc1ccc(C(C)(/C=C/CC(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C14H16O4S/c1-14(13(17)18,9-3-4-12(15)16)10-5-7-11(19-2)8-6-10/h3,5-9H,4H2,1-2H3,(H,15,16)(H,17,18)/b9-3+ |
| InChIKey | PIUZMRCREMXUFA-YCRREMRBSA-N |
| XLogP | 2.78 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|