C17H18O5 — CID 18473837
3-hydroxy-3-[4-(methoxymethoxy)phenyl]-3-phenylpropanoic acid (PubChem CID 18473837) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-hydroxy-3-[4-(methoxymethoxy)phenyl]-3-phenylpropanoic acid.
| Compound Name | 3-hydroxy-3-[4-(methoxymethoxy)phenyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18473837 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-hydroxy-3-[4-(methoxymethoxy)phenyl]-3-phenylpropanoic acid |
| SMILES | COCOc1ccc(C(O)(CC(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18O5/c1-21-12-22-15-9-7-14(8-10-15)17(20,11-16(18)19)13-5-3-2-4-6-13/h2-10,20H,11-12H2,1H3,(H,18,19) |
| InChIKey | ULZVDXJIHCXKHV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|