About 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone
1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone (PubChem CID 54405970) has the molecular formula C18H20O4
and a molecular weight of 300.35 g/mol. Its IUPAC name is 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone.
Molecular Properties
| Compound Name | 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone |
| PubChem CID | 54405970 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.COCOc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C10H12O3.C8H8O/c1-8(11)9-3-5-10(6-4-9)13-7-12-2;1-7(9)8-5-3-2-4-6-8/h3-6H,7H2,1-2H3;2-6H,1H3 |
| InChIKey | VQRUJDBWAPWUEN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone?
The IUPAC name of 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone (CID 54405970) is 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone.
What is the SMILES notation for 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone?
The canonical SMILES for 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone is CC(=O)c1ccccc1.COCOc1ccc(C(C)=O)cc1.
What is the InChIKey of 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone?
The InChIKey is VQRUJDBWAPWUEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3.C8H8O/c1-8(11)9-3-5-10(6-4-9)13-7-12-2;1-7(9)8-5-3-2-4-6-8/h3-6H,7H2,1-2H3;2-6H,1H3.
What are the key properties of 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone?
1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone has a molecular weight of 300.35 g/mol, XLogP of 3.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(methoxymethoxy)phenyl]ethanone;1-phenylethanone is sourced from PubChem (CID 54405970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).