About methoxymethyl acetate;1-phenylethanone
methoxymethyl acetate;1-phenylethanone (PubChem CID 91080565) has the molecular formula C12H16O4
and a molecular weight of 224.26 g/mol. Its IUPAC name is methoxymethyl acetate;1-phenylethanone.
Molecular Properties
| Compound Name | methoxymethyl acetate;1-phenylethanone |
| PubChem CID | 91080565 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | methoxymethyl acetate;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.COCOC(C)=O |
| InChI | InChI=1S/C8H8O.C4H8O3/c1-7(9)8-5-3-2-4-6-8;1-4(5)7-3-6-2/h2-6H,1H3;3H2,1-2H3 |
| InChIKey | PPDVZZFNXDEYOZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methoxymethyl acetate;1-phenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethyl acetate;1-phenylethanone?
The IUPAC name of methoxymethyl acetate;1-phenylethanone (CID 91080565) is methoxymethyl acetate;1-phenylethanone.
What is the SMILES notation for methoxymethyl acetate;1-phenylethanone?
The canonical SMILES for methoxymethyl acetate;1-phenylethanone is CC(=O)c1ccccc1.COCOC(C)=O.
What is the InChIKey of methoxymethyl acetate;1-phenylethanone?
The InChIKey is PPDVZZFNXDEYOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C4H8O3/c1-7(9)8-5-3-2-4-6-8;1-4(5)7-3-6-2/h2-6H,1H3;3H2,1-2H3.
What are the key properties of methoxymethyl acetate;1-phenylethanone?
methoxymethyl acetate;1-phenylethanone has a molecular weight of 224.26 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethyl acetate;1-phenylethanone is sourced from PubChem (CID 91080565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).