C16H25NO3S — CID 90160053
N,N-bis(1-ethoxyethyl)-4-methylsulfanylbenzamide (PubChem CID 90160053) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is N,N-bis(1-ethoxyethyl)-4-methylsulfanylbenzamide.
| Compound Name | N,N-bis(1-ethoxyethyl)-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 90160053 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N,N-bis(1-ethoxyethyl)-4-methylsulfanylbenzamide |
| SMILES | CCOC(C)N(C(=O)c1ccc(SC)cc1)C(C)OCC |
| InChI | InChI=1S/C16H25NO3S/c1-6-19-12(3)17(13(4)20-7-2)16(18)14-8-10-15(21-5)11-9-14/h8-13H,6-7H2,1-5H3 |
| InChIKey | XCZQJMFEFNNVNJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|