C14H23NOS — CID 145226293
N,N-diethyl-4-methylsulfanylbenzamide;ethane (PubChem CID 145226293) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is N,N-diethyl-4-methylsulfanylbenzamide;ethane.
| Compound Name | N,N-diethyl-4-methylsulfanylbenzamide;ethane |
|---|---|
| PubChem CID | 145226293 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N,N-diethyl-4-methylsulfanylbenzamide;ethane |
| SMILES | CC.CCN(CC)C(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C12H17NOS.C2H6/c1-4-13(5-2)12(14)10-6-8-11(15-3)9-7-10;1-2/h6-9H,4-5H2,1-3H3;1-2H3 |
| InChIKey | MFCTZFPFNBXQEN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |