C15H23NO — CID 60675001
4-butyl-N,N-diethylbenzamide (PubChem CID 60675001) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 4-butyl-N,N-diethylbenzamide.
| Compound Name | 4-butyl-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 60675001 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 4-butyl-N,N-diethylbenzamide |
| SMILES | CCCCc1ccc(C(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C15H23NO/c1-4-7-8-13-9-11-14(12-10-13)15(17)16(5-2)6-3/h9-12H,4-8H2,1-3H3 |
| InChIKey | BKFHBQYTIPMMML-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |