C23H40N2O — CID 58300403
4-[6-(dipropylamino)hexyl]-N,N-diethylbenzamide (PubChem CID 58300403) has the molecular formula C23H40N2O and a molecular weight of 360.59 g/mol. Its IUPAC name is 4-[6-(dipropylamino)hexyl]-N,N-diethylbenzamide.
| Compound Name | 4-[6-(dipropylamino)hexyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 58300403 |
| Molecular Formula | C23H40N2O |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.31 |
| IUPAC Name | 4-[6-(dipropylamino)hexyl]-N,N-diethylbenzamide |
| SMILES | CCCN(CCC)CCCCCCc1ccc(C(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C23H40N2O/c1-5-18-24(19-6-2)20-12-10-9-11-13-21-14-16-22(17-15-21)23(26)25(7-3)8-4/h14-17H,5-13,18-20H2,1-4H3 |
| InChIKey | WFXWZQRZEZVWDZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|