C13H16N2O — CID 82179217
4-(cyanomethyl)-N,N-diethylbenzamide (PubChem CID 82179217) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-(cyanomethyl)-N,N-diethylbenzamide.
| Compound Name | 4-(cyanomethyl)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 82179217 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4-(cyanomethyl)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(CC#N)cc1 |
| InChI | InChI=1S/C13H16N2O/c1-3-15(4-2)13(16)12-7-5-11(6-8-12)9-10-14/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | SNJXOPBOHFUBFQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |