C32H58N4O2 — CID 139953556
1-N,4-N-bis[2-[ethyl(heptyl)amino]ethyl]-1-N,4-N-dimethylbenzene-1,4-dicarboxamide (PubChem CID 139953556) has the molecular formula C32H58N4O2 and a molecular weight of 530.84 g/mol. Its IUPAC name is 1-N,4-N-bis[2-[ethyl(heptyl)amino]ethyl]-1-N,4-N-dimethylbenzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[2-[ethyl(heptyl)amino]ethyl]-1-N,4-N-dimethylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 139953556 |
| Molecular Formula | C32H58N4O2 |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 530.46 |
| IUPAC Name | 1-N,4-N-bis[2-[ethyl(heptyl)amino]ethyl]-1-N,4-N-dimethylbenzene-1,4-dicarboxamide |
| SMILES | CCCCCCCN(CC)CCN(C)C(=O)c1ccc(C(=O)N(C)CCN(CC)CCCCCCC)cc1 |
| InChI | InChI=1S/C32H58N4O2/c1-7-11-13-15-17-23-35(9-3)27-25-33(5)31(37)29-19-21-30(22-20-29)32(38)34(6)26-28-36(10-4)24-18-16-14-12-8-2/h19-22H,7-18,23-28H2,1-6H3 |
| InChIKey | GXMNOBXEEUOAEQ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|