C32H58N4O2 — CID 139952425
1-N,3-N-bis[2-[ethyl(octyl)amino]ethyl]benzene-1,3-dicarboxamide (PubChem CID 139952425) has the molecular formula C32H58N4O2 and a molecular weight of 530.84 g/mol. Its IUPAC name is 1-N,3-N-bis[2-[ethyl(octyl)amino]ethyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[2-[ethyl(octyl)amino]ethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 139952425 |
| Molecular Formula | C32H58N4O2 |
| Molecular Weight | 530.84 g/mol |
| Exact Mass | 530.46 |
| IUPAC Name | 1-N,3-N-bis[2-[ethyl(octyl)amino]ethyl]benzene-1,3-dicarboxamide |
| SMILES | CCCCCCCCN(CC)CCNC(=O)c1cccc(C(=O)NCCN(CC)CCCCCCCC)c1 |
| InChI | InChI=1S/C32H58N4O2/c1-5-9-11-13-15-17-24-35(7-3)26-22-33-31(37)29-20-19-21-30(28-29)32(38)34-23-27-36(8-4)25-18-16-14-12-10-6-2/h19-21,28H,5-18,22-27H2,1-4H3,(H,33,37)(H,34,38) |
| InChIKey | AOLHENIVUPZCIB-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.84 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|