C28H50N4O2 — CID 139956379
1-N,3-N-bis[2-(dibutylamino)ethyl]benzene-1,3-dicarboxamide (PubChem CID 139956379) has the molecular formula C28H50N4O2 and a molecular weight of 474.73 g/mol. Its IUPAC name is 1-N,3-N-bis[2-(dibutylamino)ethyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[2-(dibutylamino)ethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 139956379 |
| Molecular Formula | C28H50N4O2 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.39 |
| IUPAC Name | 1-N,3-N-bis[2-(dibutylamino)ethyl]benzene-1,3-dicarboxamide |
| SMILES | CCCCN(CCCC)CCNC(=O)c1cccc(C(=O)NCCN(CCCC)CCCC)c1 |
| InChI | InChI=1S/C28H50N4O2/c1-5-9-18-31(19-10-6-2)22-16-29-27(33)25-14-13-15-26(24-25)28(34)30-17-23-32(20-11-7-3)21-12-8-4/h13-15,24H,5-12,16-23H2,1-4H3,(H,29,33)(H,30,34) |
| InChIKey | ITYPTDLIAIHAIA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |