C13H20BrClN2O — CID 2941785
3-bromo-N-[2-(diethylamino)ethyl]benzamide;hydrochloride (PubChem CID 2941785) has the molecular formula C13H20BrClN2O and a molecular weight of 335.67 g/mol. Its IUPAC name is 3-bromo-N-[2-(diethylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 3-bromo-N-[2-(diethylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 2941785 |
| Molecular Formula | C13H20BrClN2O |
| Molecular Weight | 335.67 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 3-bromo-N-[2-(diethylamino)ethyl]benzamide;hydrochloride |
| SMILES | CCN(CC)CCNC(=O)c1cccc(Br)c1.Cl |
| InChI | InChI=1S/C13H19BrN2O.ClH/c1-3-16(4-2)9-8-15-13(17)11-6-5-7-12(14)10-11;/h5-7,10H,3-4,8-9H2,1-2H3,(H,15,17);1H |
| InChIKey | LJLBPBFIKGMZLW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |