C21H30Cl2N4O2 — CID 119847686
3-[[4-(aminomethyl)benzoyl]amino]-N-[2-(diethylamino)ethyl]benzamide;dihydrochloride (PubChem CID 119847686) has the molecular formula C21H30Cl2N4O2 and a molecular weight of 441.40 g/mol. Its IUPAC name is 3-[[4-(aminomethyl)benzoyl]amino]-N-[2-(diethylamino)ethyl]benzamide;dihydrochloride.
| Compound Name | 3-[[4-(aminomethyl)benzoyl]amino]-N-[2-(diethylamino)ethyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119847686 |
| Molecular Formula | C21H30Cl2N4O2 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 3-[[4-(aminomethyl)benzoyl]amino]-N-[2-(diethylamino)ethyl]benzamide;dihydrochloride |
| SMILES | CCN(CC)CCNC(=O)c1cccc(NC(=O)c2ccc(CN)cc2)c1.Cl.Cl |
| InChI | InChI=1S/C21H28N4O2.2ClH/c1-3-25(4-2)13-12-23-20(26)18-6-5-7-19(14-18)24-21(27)17-10-8-16(15-22)9-11-17;;/h5-11,14H,3-4,12-13,15,22H2,1-2H3,(H,23,26)(H,24,27);2*1H |
| InChIKey | LTLZUFVMIAUXCB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |