C34H62N4O2 — CID 139953389
1-N,3-N-bis[2-[decyl(methyl)amino]ethyl]benzene-1,3-dicarboxamide (PubChem CID 139953389) has the molecular formula C34H62N4O2 and a molecular weight of 558.90 g/mol. Its IUPAC name is 1-N,3-N-bis[2-[decyl(methyl)amino]ethyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[2-[decyl(methyl)amino]ethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 139953389 |
| Molecular Formula | C34H62N4O2 |
| Molecular Weight | 558.90 g/mol |
| Exact Mass | 558.49 |
| IUPAC Name | 1-N,3-N-bis[2-[decyl(methyl)amino]ethyl]benzene-1,3-dicarboxamide |
| SMILES | CCCCCCCCCCN(C)CCNC(=O)c1cccc(C(=O)NCCN(C)CCCCCCCCCC)c1 |
| InChI | InChI=1S/C34H62N4O2/c1-5-7-9-11-13-15-17-19-26-37(3)28-24-35-33(39)31-22-21-23-32(30-31)34(40)36-25-29-38(4)27-20-18-16-14-12-10-8-6-2/h21-23,30H,5-20,24-29H2,1-4H3,(H,35,39)(H,36,40) |
| InChIKey | SBRQDJBMKCEUPZ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.90 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|