C14H20BrNO — CID 107206029
N-(5-bromopentyl)-N,4-dimethylbenzamide (PubChem CID 107206029) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is N-(5-bromopentyl)-N,4-dimethylbenzamide.
| Compound Name | N-(5-bromopentyl)-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 107206029 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-(5-bromopentyl)-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)CCCCCBr)cc1 |
| InChI | InChI=1S/C14H20BrNO/c1-12-6-8-13(9-7-12)14(17)16(2)11-5-3-4-10-15/h6-9H,3-5,10-11H2,1-2H3 |
| InChIKey | BLPWJOPENPVDGI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|