C14H19Br2NO — CID 107206197
5-bromo-N-(5-bromopentyl)-N,2-dimethylbenzamide (PubChem CID 107206197) has the molecular formula C14H19Br2NO and a molecular weight of 377.12 g/mol. Its IUPAC name is 5-bromo-N-(5-bromopentyl)-N,2-dimethylbenzamide.
| Compound Name | 5-bromo-N-(5-bromopentyl)-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 107206197 |
| Molecular Formula | C14H19Br2NO |
| Molecular Weight | 377.12 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 5-bromo-N-(5-bromopentyl)-N,2-dimethylbenzamide |
| SMILES | Cc1ccc(Br)cc1C(=O)N(C)CCCCCBr |
| InChI | InChI=1S/C14H19Br2NO/c1-11-6-7-12(16)10-13(11)14(18)17(2)9-5-3-4-8-15/h6-7,10H,3-5,8-9H2,1-2H3 |
| InChIKey | ZCCNLFSFTBSIKH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.12 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|