C15H21BrN2O2 — CID 65309366
5-bromo-N-[2-(diethylamino)-2-oxoethyl]-N,2-dimethylbenzamide (PubChem CID 65309366) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is 5-bromo-N-[2-(diethylamino)-2-oxoethyl]-N,2-dimethylbenzamide.
| Compound Name | 5-bromo-N-[2-(diethylamino)-2-oxoethyl]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 65309366 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 5-bromo-N-[2-(diethylamino)-2-oxoethyl]-N,2-dimethylbenzamide |
| SMILES | CCN(CC)C(=O)CN(C)C(=O)c1cc(Br)ccc1C |
| InChI | InChI=1S/C15H21BrN2O2/c1-5-18(6-2)14(19)10-17(4)15(20)13-9-12(16)8-7-11(13)3/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | WGRWGZNTMOHLKM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |