C36H66N4O2 — CID 139952652
1-N,4-N-bis[2-[ethyl(nonyl)amino]ethyl]-1-N,4-N-dimethylbenzene-1,4-dicarboxamide (PubChem CID 139952652) has the molecular formula C36H66N4O2 and a molecular weight of 586.95 g/mol. Its IUPAC name is 1-N,4-N-bis[2-[ethyl(nonyl)amino]ethyl]-1-N,4-N-dimethylbenzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[2-[ethyl(nonyl)amino]ethyl]-1-N,4-N-dimethylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 139952652 |
| Molecular Formula | C36H66N4O2 |
| Molecular Weight | 586.95 g/mol |
| Exact Mass | 586.52 |
| IUPAC Name | 1-N,4-N-bis[2-[ethyl(nonyl)amino]ethyl]-1-N,4-N-dimethylbenzene-1,4-dicarboxamide |
| SMILES | CCCCCCCCCN(CC)CCN(C)C(=O)c1ccc(C(=O)N(C)CCN(CC)CCCCCCCCC)cc1 |
| InChI | InChI=1S/C36H66N4O2/c1-7-11-13-15-17-19-21-27-39(9-3)31-29-37(5)35(41)33-23-25-34(26-24-33)36(42)38(6)30-32-40(10-4)28-22-20-18-16-14-12-8-2/h23-26H,7-22,27-32H2,1-6H3 |
| InChIKey | FGWBPCITCMNTOT-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.95 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|