C19H23NO2 — CID 146305996
4-(4-butylphenoxy)-N,N-dimethylbenzamide (PubChem CID 146305996) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-(4-butylphenoxy)-N,N-dimethylbenzamide.
| Compound Name | 4-(4-butylphenoxy)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 146305996 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 4-(4-butylphenoxy)-N,N-dimethylbenzamide |
| SMILES | CCCCc1ccc(Oc2ccc(C(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H23NO2/c1-4-5-6-15-7-11-17(12-8-15)22-18-13-9-16(10-14-18)19(21)20(2)3/h7-14H,4-6H2,1-3H3 |
| InChIKey | SFVGWJUPQQLVPD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |